C22H27N3O2S — CID 67866479
(3aS,7aR)-2-[5-amino-6-(1H-indol-3-ylsulfanyl)hexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 67866479) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is (3aS,7aR)-2-[5-amino-6-(1H-indol-3-ylsulfanyl)hexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[5-amino-6-(1H-indol-3-ylsulfanyl)hexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67866479 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (3aS,7aR)-2-[5-amino-6-(1H-indol-3-ylsulfanyl)hexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | NC(CCCCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)CSc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H27N3O2S/c23-15(14-28-20-13-24-19-11-4-3-10-18(19)20)7-5-6-12-25-21(26)16-8-1-2-9-17(16)22(25)27/h1-4,10-11,13,15-17,24H,5-9,12,14,23H2/t15?,16-,17+ |
| InChIKey | VHDJWOMYBRVJOY-ALOPSCKCSA-N |
| XLogP | 3.71 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|