C20H32N2O3 — CID 67866592
tert-butyl (2R,3R,4S)-4-amino-3-hydroxy-4-(3-methylbutylamino)-2,3-dihydro-1H-naphthalene-2-carboxylate (PubChem CID 67866592) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S)-4-amino-3-hydroxy-4-(3-methylbutylamino)-2,3-dihydro-1H-naphthalene-2-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S)-4-amino-3-hydroxy-4-(3-methylbutylamino)-2,3-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 67866592 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl (2R,3R,4S)-4-amino-3-hydroxy-4-(3-methylbutylamino)-2,3-dihydro-1H-naphthalene-2-carboxylate |
| SMILES | CC(C)CCN[C@@]1(N)c2ccccc2C[C@@H](C(=O)OC(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C20H32N2O3/c1-13(2)10-11-22-20(21)16-9-7-6-8-14(16)12-15(17(20)23)18(24)25-19(3,4)5/h6-9,13,15,17,22-23H,10-12,21H2,1-5H3/t15-,17-,20+/m1/s1 |
| InChIKey | DHCALOWCRARWDW-MDYRTPRTSA-N |
| XLogP | 2.31 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|