About 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol
3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol (PubChem CID 67866608) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol.
Molecular Properties
| Compound Name | 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol |
| PubChem CID | 67866608 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol |
| SMILES | CC(C)=CCCC(C)(O)C(O)CNc1ccccc1C |
| InChI | InChI=1S/C17H27NO2/c1-13(2)8-7-11-17(4,20)16(19)12-18-15-10-6-5-9-14(15)3/h5-6,8-10,16,18-20H,7,11-12H2,1-4H3 |
| InChIKey | PXHYCOKPAHSNDA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol?
The IUPAC name of 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol (CID 67866608) is 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol.
What is the SMILES notation for 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol?
The canonical SMILES for 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol is CC(C)=CCCC(C)(O)C(O)CNc1ccccc1C.
What is the InChIKey of 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol?
The InChIKey is PXHYCOKPAHSNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-13(2)8-7-11-17(4,20)16(19)12-18-15-10-6-5-9-14(15)3/h5-6,8-10,16,18-20H,7,11-12H2,1-4H3.
What are the key properties of 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol?
3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol has a molecular weight of 277.41 g/mol, XLogP of 3.27, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-1-(2-methylanilino)oct-6-ene-2,3-diol is sourced from PubChem (CID 67866608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).