C21H26N2O4 — CID 67866774
prop-2-enyl 2-[(2S)-5-benzylidene-3,6-dioxo-1-pentylpiperazin-2-yl]acetate (PubChem CID 67866774) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is prop-2-enyl 2-[(2S)-5-benzylidene-3,6-dioxo-1-pentylpiperazin-2-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2S)-5-benzylidene-3,6-dioxo-1-pentylpiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 67866774 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | prop-2-enyl 2-[(2S)-5-benzylidene-3,6-dioxo-1-pentylpiperazin-2-yl]acetate |
| SMILES | C=CCOC(=O)C[C@H]1C(=O)NC(=Cc2ccccc2)C(=O)N1CCCCC |
| InChI | InChI=1S/C21H26N2O4/c1-3-5-9-12-23-18(15-19(24)27-13-4-2)20(25)22-17(21(23)26)14-16-10-7-6-8-11-16/h4,6-8,10-11,14,18H,2-3,5,9,12-13,15H2,1H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | XHAYEJOSOPWEQB-SFHVURJKSA-N |
| XLogP | 2.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|