About 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole
1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole (PubChem CID 67866947) has the molecular formula C15H29N3
and a molecular weight of 251.42 g/mol. Its IUPAC name is 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole.
Molecular Properties
| Compound Name | 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole |
| PubChem CID | 67866947 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole |
| SMILES | C=C(CCCCC)C(CCCCC)N1CCN=N1 |
| InChI | InChI=1S/C15H29N3/c1-4-6-8-10-14(3)15(11-9-7-5-2)18-13-12-16-17-18/h15H,3-13H2,1-2H3 |
| InChIKey | LXDYICAPXINSNN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole?
The IUPAC name of 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole (CID 67866947) is 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole.
What is the SMILES notation for 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole?
The canonical SMILES for 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole is C=C(CCCCC)C(CCCCC)N1CCN=N1.
What is the InChIKey of 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole?
The InChIKey is LXDYICAPXINSNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3/c1-4-6-8-10-14(3)15(11-9-7-5-2)18-13-12-16-17-18/h15H,3-13H2,1-2H3.
What are the key properties of 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole?
1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole has a molecular weight of 251.42 g/mol, XLogP of 4.75, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methylidenedodecan-6-yl)-4,5-dihydrotriazole is sourced from PubChem (CID 67866947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).