About 2,3-dimethyl-1,3-oxazolidin-2-amine
2,3-dimethyl-1,3-oxazolidin-2-amine (PubChem CID 67867295) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-oxazolidin-2-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1,3-oxazolidin-2-amine |
| PubChem CID | 67867295 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 2,3-dimethyl-1,3-oxazolidin-2-amine |
| SMILES | CN1CCOC1(C)N |
| InChI | InChI=1S/C5H12N2O/c1-5(6)7(2)3-4-8-5/h3-4,6H2,1-2H3 |
| InChIKey | OPZYVOZVSWUQCW-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-1,3-oxazolidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,3-oxazolidin-2-amine?
The IUPAC name of 2,3-dimethyl-1,3-oxazolidin-2-amine (CID 67867295) is 2,3-dimethyl-1,3-oxazolidin-2-amine.
What is the SMILES notation for 2,3-dimethyl-1,3-oxazolidin-2-amine?
The canonical SMILES for 2,3-dimethyl-1,3-oxazolidin-2-amine is CN1CCOC1(C)N.
What is the InChIKey of 2,3-dimethyl-1,3-oxazolidin-2-amine?
The InChIKey is OPZYVOZVSWUQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-5(6)7(2)3-4-8-5/h3-4,6H2,1-2H3.
What are the key properties of 2,3-dimethyl-1,3-oxazolidin-2-amine?
2,3-dimethyl-1,3-oxazolidin-2-amine has a molecular weight of 116.16 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,3-oxazolidin-2-amine is sourced from PubChem (CID 67867295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).