About 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol
6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol (PubChem CID 67867547) has the molecular formula C25H30N2O2
and a molecular weight of 390.53 g/mol. Its IUPAC name is 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol.
Molecular Properties
| Compound Name | 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol |
| PubChem CID | 67867547 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCCOc1cc(-c2ccc(N)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H30N2O2/c1-25(2,18-28)14-6-7-15-29-24-17-21(19-10-12-22(26)13-11-19)16-23(27-24)20-8-4-3-5-9-20/h3-5,8-13,16-17,28H,6-7,14-15,18,26H2,1-2H3 |
| InChIKey | REGGLCLLAYHVHG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol?
The IUPAC name of 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol (CID 67867547) is 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol.
What is the SMILES notation for 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol?
The canonical SMILES for 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol is CC(C)(CO)CCCCOc1cc(-c2ccc(N)cc2)cc(-c2ccccc2)n1.
What is the InChIKey of 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol?
The InChIKey is REGGLCLLAYHVHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O2/c1-25(2,18-28)14-6-7-15-29-24-17-21(19-10-12-22(26)13-11-19)16-23(27-24)20-8-4-3-5-9-20/h3-5,8-13,16-17,28H,6-7,14-15,18,26H2,1-2H3.
What are the key properties of 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol?
6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol has a molecular weight of 390.53 g/mol, XLogP of 5.57, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-ol is sourced from PubChem (CID 67867547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).