C11H14ClNO2 — CID 67868081
6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride (PubChem CID 67868081) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride.
| Compound Name | 6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67868081 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CCCC2C(=O)O |
| InChI | InChI=1S/C11H13NO2.ClH/c12-8-4-5-9-7(6-8)2-1-3-10(9)11(13)14;/h4-6,10H,1-3,12H2,(H,13,14);1H |
| InChIKey | QFCZKXTVCFUSTO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|