About (6E)-1,4-benzodiazonin-3-one
(6E)-1,4-benzodiazonin-3-one (PubChem CID 67868082) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is (6E)-1,4-benzodiazonin-3-one.
Molecular Properties
| Compound Name | (6E)-1,4-benzodiazonin-3-one |
| PubChem CID | 67868082 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (6E)-1,4-benzodiazonin-3-one |
| SMILES | O=C1/C=N/c2ccccc2/C=C/C=N\1 |
| InChI | InChI=1S/C11H8N2O/c14-11-8-13-10-6-2-1-4-9(10)5-3-7-12-11/h1-8H/b5-3+,12-7-,13-8+ |
| InChIKey | WUQSGDSBVFPSHO-ZDDGDYGUSA-N |
| XLogP | 2.01 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6E)-1,4-benzodiazonin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-1,4-benzodiazonin-3-one?
The IUPAC name of (6E)-1,4-benzodiazonin-3-one (CID 67868082) is (6E)-1,4-benzodiazonin-3-one.
What is the SMILES notation for (6E)-1,4-benzodiazonin-3-one?
The canonical SMILES for (6E)-1,4-benzodiazonin-3-one is O=C1/C=N/c2ccccc2/C=C/C=N\1.
What is the InChIKey of (6E)-1,4-benzodiazonin-3-one?
The InChIKey is WUQSGDSBVFPSHO-ZDDGDYGUSA-N. The full InChI is InChI=1S/C11H8N2O/c14-11-8-13-10-6-2-1-4-9(10)5-3-7-12-11/h1-8H/b5-3+,12-7-,13-8+.
What are the key properties of (6E)-1,4-benzodiazonin-3-one?
(6E)-1,4-benzodiazonin-3-one has a molecular weight of 184.20 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-1,4-benzodiazonin-3-one is sourced from PubChem (CID 67868082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).