C18H29N3O9 — CID 67868233
[(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(1,4-diamino-1-oxobutan-2-yl)oxan-2-yl]methyl acetate (PubChem CID 67868233) has the molecular formula C18H29N3O9 and a molecular weight of 431.44 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(1,4-diamino-1-oxobutan-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(1,4-diamino-1-oxobutan-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67868233 |
| Molecular Formula | C18H29N3O9 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(1,4-diamino-1-oxobutan-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1C(CCN)C(N)=O |
| InChI | InChI=1S/C18H29N3O9/c1-8(22)21-14-15(12(5-6-19)18(20)26)30-13(7-27-9(2)23)16(28-10(3)24)17(14)29-11(4)25/h12-17H,5-7,19H2,1-4H3,(H2,20,26)(H,21,22)/t12?,13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | ZKRQPFGTBMUBNG-HUVXYLLVSA-N |
| XLogP | -1.86 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|