C12H15Cl2N — CID 67869522
(3S,4R)-1-(chloromethyl)-3,4-dimethyl-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 67869522) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is (3S,4R)-1-(chloromethyl)-3,4-dimethyl-3,4-dihydroisoquinoline;hydrochloride.
| Compound Name | (3S,4R)-1-(chloromethyl)-3,4-dimethyl-3,4-dihydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 67869522 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (3S,4R)-1-(chloromethyl)-3,4-dimethyl-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | C[C@@H]1N=C(CCl)c2ccccc2[C@H]1C.Cl |
| InChI | InChI=1S/C12H14ClN.ClH/c1-8-9(2)14-12(7-13)11-6-4-3-5-10(8)11;/h3-6,8-9H,7H2,1-2H3;1H/t8-,9-;/m0./s1 |
| InChIKey | MYIJMUUHZCPHHM-OZZZDHQUSA-N |
| XLogP | 3.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|