About 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride
3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride (PubChem CID 67869524) has the molecular formula C5H6ClNO2S
and a molecular weight of 179.63 g/mol. Its IUPAC name is 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride |
| PubChem CID | 67869524 |
| Molecular Formula | C5H6ClNO2S |
| Molecular Weight | 179.63 g/mol |
| Exact Mass | 178.98 |
| IUPAC Name | 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(C(=O)O)sn1.Cl |
| InChI | InChI=1S/C5H5NO2S.ClH/c1-3-2-4(5(7)8)9-6-3;/h2H,1H3,(H,7,8);1H |
| InChIKey | FSYNLSJPMRQXHL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride?
The IUPAC name of 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride (CID 67869524) is 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride?
The canonical SMILES for 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride is Cc1cc(C(=O)O)sn1.Cl.
What is the InChIKey of 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride?
The InChIKey is FSYNLSJPMRQXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2S.ClH/c1-3-2-4(5(7)8)9-6-3;/h2H,1H3,(H,7,8);1H.
What are the key properties of 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride?
3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride has a molecular weight of 179.63 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2-thiazole-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 67869524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).