C21H22FN3O2 — CID 6786963
N-[1-(2-cinnamylidenehydrazinyl)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 6786963) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-[1-(2-cinnamylidenehydrazinyl)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-(2-cinnamylidenehydrazinyl)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 6786963 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[1-(2-cinnamylidenehydrazinyl)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NN=CC=Cc1ccccc1 |
| InChI | InChI=1S/C21H22FN3O2/c1-15(2)19(24-20(26)17-12-6-7-13-18(17)22)21(27)25-23-14-8-11-16-9-4-3-5-10-16/h3-15,19H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | FHMFGKYBYYCPEU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|