About 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline
1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline (PubChem CID 67869630) has the molecular formula C13H14N8O5S
and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline.
Molecular Properties
| Compound Name | 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline |
| PubChem CID | 67869630 |
| Molecular Formula | C13H14N8O5S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline |
| SMILES | COc1ccnc(-n2cnc(S(N)(=O)=O)n2)n1.Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N6O3S.C6H6N2O2/c1-16-5-2-3-9-6(11-5)13-4-10-7(12-13)17(8,14)15;7-5-3-1-2-4-6(5)8(9)10/h2-4H,1H3,(H2,8,14,15);1-4H,7H2 |
| InChIKey | IMSYVXUYVFGZIN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 195.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline?
The IUPAC name of 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline (CID 67869630) is 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline.
What is the SMILES notation for 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline?
The canonical SMILES for 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline is COc1ccnc(-n2cnc(S(N)(=O)=O)n2)n1.Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline?
The InChIKey is IMSYVXUYVFGZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6O3S.C6H6N2O2/c1-16-5-2-3-9-6(11-5)13-4-10-7(12-13)17(8,14)15;7-5-3-1-2-4-6(5)8(9)10/h2-4H,1H3,(H2,8,14,15);1-4H,7H2.
What are the key properties of 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline?
1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline has a molecular weight of 394.37 g/mol, XLogP of -0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxypyrimidin-2-yl)-1,2,4-triazole-3-sulfonamide;2-nitroaniline is sourced from PubChem (CID 67869630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).