C21H23NS — CID 67869684
5-methyl-2-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridine (PubChem CID 67869684) has the molecular formula C21H23NS and a molecular weight of 321.49 g/mol. Its IUPAC name is 5-methyl-2-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridine.
| Compound Name | 5-methyl-2-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridine |
|---|---|
| PubChem CID | 67869684 |
| Molecular Formula | C21H23NS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 5-methyl-2-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridine |
| SMILES | Cc1ccc(C#Cc2ccc3c(c2)C(C)(C)CC(C)(C)S3)nc1 |
| InChI | InChI=1S/C21H23NS/c1-15-6-9-17(22-13-15)10-7-16-8-11-19-18(12-16)20(2,3)14-21(4,5)23-19/h6,8-9,11-13H,14H2,1-5H3 |
| InChIKey | LGWVWVOKXNFHGK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|