C23H25N3O6 — CID 67870089
(2S)-2-[[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-benzoylamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 67870089) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (2S)-2-[[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-benzoylamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-benzoylamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 67870089 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2S)-2-[[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-benzoylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(=O)N1CCC[C@H]1C(=O)NN(C(=O)c1ccccc1)[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H25N3O6/c1-15(27)25-13-5-8-19(25)21(29)24-26(22(30)17-6-3-2-4-7-17)20(23(31)32)14-16-9-11-18(28)12-10-16/h2-4,6-7,9-12,19-20,28H,5,8,13-14H2,1H3,(H,24,29)(H,31,32)/t19-,20-/m0/s1 |
| InChIKey | UUXXWZNLOOQVHY-PMACEKPBSA-N |
| XLogP | 1.57 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|