C16H22N2 — CID 67870325
2,3,4,4a,5,6,8,8a,9,10-decahydro-1H-isoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67870325) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,3,4,4a,5,6,8,8a,9,10-decahydro-1H-isoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | 2,3,4,4a,5,6,8,8a,9,10-decahydro-1H-isoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67870325 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,3,4,4a,5,6,8,8a,9,10-decahydro-1H-isoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | C1=NC2=CC3=C4CCCCC4CCN3CC2CC1 |
| InChI | InChI=1S/C16H22N2/c1-2-6-14-12(4-1)7-9-18-11-13-5-3-8-17-15(13)10-16(14)18/h8,10,12-13H,1-7,9,11H2 |
| InChIKey | JGLJMELUKKELMV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |