C10H14O5S — CID 67870564
2,2-dimethyl-5-(3-methylsulfanylpropanoyl)-1,3-dioxane-4,6-dione (PubChem CID 67870564) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylsulfanylpropanoyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(3-methylsulfanylpropanoyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 67870564 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylsulfanylpropanoyl)-1,3-dioxane-4,6-dione |
| SMILES | CSCCC(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C10H14O5S/c1-10(2)14-8(12)7(9(13)15-10)6(11)4-5-16-3/h7H,4-5H2,1-3H3 |
| InChIKey | KAUYFHSZYOUXSC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|