About 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride
4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride (PubChem CID 67870710) has the molecular formula C12H20Cl2N4O2
and a molecular weight of 323.22 g/mol. Its IUPAC name is 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride |
| PubChem CID | 67870710 |
| Molecular Formula | C12H20Cl2N4O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)CCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C12H18N4O2.2ClH/c17-11(18)3-1-6-15-7-9-16(10-8-15)12-13-4-2-5-14-12;;/h2,4-5H,1,3,6-10H2,(H,17,18);2*1H |
| InChIKey | NUWZXWQYCYJNQV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride?
The IUPAC name of 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride (CID 67870710) is 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride.
What is the SMILES notation for 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride?
The canonical SMILES for 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride is Cl.Cl.O=C(O)CCCN1CCN(c2ncccn2)CC1.
What is the InChIKey of 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride?
The InChIKey is NUWZXWQYCYJNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2.2ClH/c17-11(18)3-1-6-15-7-9-16(10-8-15)12-13-4-2-5-14-12;;/h2,4-5H,1,3,6-10H2,(H,17,18);2*1H.
What are the key properties of 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride?
4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride has a molecular weight of 323.22 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-pyrimidin-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride is sourced from PubChem (CID 67870710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).