About (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid
(2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid (PubChem CID 67870954) has the molecular formula C12H10N2O3
and a molecular weight of 230.22 g/mol. Its IUPAC name is (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid.
Molecular Properties
| Compound Name | (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid |
| PubChem CID | 67870954 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid |
| SMILES | CC(=O)/C(=C/c1cnn2ccccc12)C(=O)O |
| InChI | InChI=1S/C12H10N2O3/c1-8(15)10(12(16)17)6-9-7-13-14-5-3-2-4-11(9)14/h2-7H,1H3,(H,16,17)/b10-6- |
| InChIKey | DARJDNKBDYEDBD-POHAHGRESA-N |
| XLogP | 1.39 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid?
The IUPAC name of (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid (CID 67870954) is (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid.
What is the SMILES notation for (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid?
The canonical SMILES for (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid is CC(=O)/C(=C/c1cnn2ccccc12)C(=O)O.
What is the InChIKey of (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid?
The InChIKey is DARJDNKBDYEDBD-POHAHGRESA-N. The full InChI is InChI=1S/C12H10N2O3/c1-8(15)10(12(16)17)6-9-7-13-14-5-3-2-4-11(9)14/h2-7H,1H3,(H,16,17)/b10-6-.
What are the key properties of (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid?
(2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid has a molecular weight of 230.22 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-oxo-2-(pyrazolo[1,5-a]pyridin-3-ylmethylidene)butanoic acid is sourced from PubChem (CID 67870954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).