C28H34N2O2S — CID 67871217
N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide (PubChem CID 67871217) has the molecular formula C28H34N2O2S and a molecular weight of 462.66 g/mol. Its IUPAC name is N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 67871217 |
| Molecular Formula | C28H34N2O2S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide |
| SMILES | CC1(C)[C@H]2C[C@H](C/C=C\CCCC#N)[C@@H](NS(=O)(=O)c3ccc(-c4ccccc4)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C28H34N2O2S/c1-28(2)24-19-23(13-7-4-3-5-10-18-29)27(26(28)20-24)30-33(31,32)25-16-14-22(15-17-25)21-11-8-6-9-12-21/h4,6-9,11-12,14-17,23-24,26-27,30H,3,5,10,13,19-20H2,1-2H3/b7-4-/t23-,24-,26-,27+/m0/s1 |
| InChIKey | KGGJAAIIIDQVOF-SYZNVSBMSA-N |
| XLogP | 6.32 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|