C40H54N4O14S2 — CID 67871320
2,3-dihydroxybutanedioate;bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13-aza-19-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene) (PubChem CID 67871320) has the molecular formula C40H54N4O14S2 and a molecular weight of 879.02 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioate;bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13-aza-19-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene).
| Compound Name | 2,3-dihydroxybutanedioate;bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13-aza-19-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene) |
|---|---|
| PubChem CID | 67871320 |
| Molecular Formula | C40H54N4O14S2 |
| Molecular Weight | 879.02 g/mol |
| Exact Mass | 878.31 |
| IUPAC Name | 2,3-dihydroxybutanedioate;bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13-aza-19-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene) |
| SMILES | CS(=O)(=O)[NH+]1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5.CS(=O)(=O)[NH+]1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5.O=C([O-])C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/2C18H24N2O4S.C4H6O6/c2*1-25(21,22)20-5-2-3-13-10-19-6-4-12-7-17-18(24-11-23-17)8-14(12)16(19)9-15(13)20;5-1(3(7)8)2(6)4(9)10/h2*7-8,13,15-16H,2-6,9-11H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t2*13-,15+,16+;/m11./s1 |
| InChIKey | RPKGMUHKYGZQQK-CCRAPGDGSA-N |
| XLogP | -4.11 |
| TPSA | 241.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.02 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |