About [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate
[5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate (PubChem CID 67871545) has the molecular formula C22H20ClN3O5
and a molecular weight of 441.87 g/mol. Its IUPAC name is [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate |
| PubChem CID | 67871545 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ncc2[nH]c3cccc(Oc4ccc(N)cc4Cl)c3c2c1COC |
| InChI | InChI=1S/C22H20ClN3O5/c1-3-29-22(27)31-21-13(11-28-2)19-16(10-25-21)26-15-5-4-6-18(20(15)19)30-17-8-7-12(24)9-14(17)23/h4-10,26H,3,11,24H2,1-2H3 |
| InChIKey | UXHWZLUVBWBROU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The IUPAC name of [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate (CID 67871545) is [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate.
What is the SMILES notation for [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The canonical SMILES for [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate is CCOC(=O)Oc1ncc2[nH]c3cccc(Oc4ccc(N)cc4Cl)c3c2c1COC.
What is the InChIKey of [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The InChIKey is UXHWZLUVBWBROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClN3O5/c1-3-29-22(27)31-21-13(11-28-2)19-16(10-25-21)26-15-5-4-6-18(20(15)19)30-17-8-7-12(24)9-14(17)23/h4-10,26H,3,11,24H2,1-2H3.
What are the key properties of [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
[5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate has a molecular weight of 441.87 g/mol, XLogP of 5.43, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate is sourced from PubChem (CID 67871545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).