C23H20FN3O5 — CID 67871625
5-[[(7-fluoro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 67871625) has the molecular formula C23H20FN3O5 and a molecular weight of 437.43 g/mol. Its IUPAC name is 5-[[(7-fluoro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(7-fluoro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 67871625 |
| Molecular Formula | C23H20FN3O5 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 5-[[(7-fluoro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CN1C(=O)C(NC=C2C(=O)OC(C)(C)OC2=O)N=C(c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H20FN3O5/c1-23(2)31-21(29)16(22(30)32-23)12-25-19-20(28)27(3)17-10-9-14(24)11-15(17)18(26-19)13-7-5-4-6-8-13/h4-12,19,25H,1-3H3 |
| InChIKey | PGQNHHXQXMSVPW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|