About [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate
[5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate (PubChem CID 67871766) has the molecular formula C20H15ClN2O5
and a molecular weight of 398.80 g/mol. Its IUPAC name is [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate |
| PubChem CID | 67871766 |
| Molecular Formula | C20H15ClN2O5 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate |
| SMILES | COCc1c(OC(=O)O)ncc2[nH]c3cccc(Oc4ccc(Cl)cc4)c3c12 |
| InChI | InChI=1S/C20H15ClN2O5/c1-26-10-13-17-15(9-22-19(13)28-20(24)25)23-14-3-2-4-16(18(14)17)27-12-7-5-11(21)6-8-12/h2-9,23H,10H2,1H3,(H,24,25) |
| InChIKey | AGIZODKUYHZEJA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate?
The IUPAC name of [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate (CID 67871766) is [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate.
What is the SMILES notation for [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate?
The canonical SMILES for [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate is COCc1c(OC(=O)O)ncc2[nH]c3cccc(Oc4ccc(Cl)cc4)c3c12.
What is the InChIKey of [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate?
The InChIKey is AGIZODKUYHZEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN2O5/c1-26-10-13-17-15(9-22-19(13)28-20(24)25)23-14-3-2-4-16(18(14)17)27-12-7-5-11(21)6-8-12/h2-9,23H,10H2,1H3,(H,24,25).
What are the key properties of [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate?
[5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate has a molecular weight of 398.80 g/mol, XLogP of 5.36, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] hydrogen carbonate is sourced from PubChem (CID 67871766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).