C9H10N4 — CID 67871841
4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(13),7,9,11-tetraene (PubChem CID 67871841) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(13),7,9,11-tetraene.
| Compound Name | 4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(13),7,9,11-tetraene |
|---|---|
| PubChem CID | 67871841 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(13),7,9,11-tetraene |
| SMILES | C1=CC2NNCC2C2=CN=NC2=C1 |
| InChI | InChI=1S/C9H10N4/c1-2-8-6(4-10-12-8)7-5-11-13-9(7)3-1/h1-4,7,9,11,13H,5H2 |
| InChIKey | CNPSIJQETBMUKK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |