About 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine
1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine (PubChem CID 67872185) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine |
| PubChem CID | 67872185 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)c1cc(OC)ccc1-c1ccccc1 |
| InChI | InChI=1S/C16H19N3O/c1-18-16(17)19(2)15-11-13(20-3)9-10-14(15)12-7-5-4-6-8-12/h4-11H,1-3H3,(H2,17,18) |
| InChIKey | BAAZSUOOUJCUEI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine?
The IUPAC name of 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine (CID 67872185) is 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine.
What is the SMILES notation for 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine?
The canonical SMILES for 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine is C/N=C(\N)N(C)c1cc(OC)ccc1-c1ccccc1.
What is the InChIKey of 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine?
The InChIKey is BAAZSUOOUJCUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O/c1-18-16(17)19(2)15-11-13(20-3)9-10-14(15)12-7-5-4-6-8-12/h4-11H,1-3H3,(H2,17,18).
What are the key properties of 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine?
1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine has a molecular weight of 269.35 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-2-phenylphenyl)-1,2-dimethylguanidine is sourced from PubChem (CID 67872185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).