C13H10N2 — CID 67872328
2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),3,6,8,10,12-hexaene (PubChem CID 67872328) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),3,6,8,10,12-hexaene.
| Compound Name | 2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),3,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 67872328 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),3,6,8,10,12-hexaene |
| SMILES | C1=CCC2=CN3C4=CC=C(C4)C3=NC2=C1 |
| InChI | InChI=1S/C13H10N2/c1-2-4-12-10(3-1)8-15-11-6-5-9(7-11)13(15)14-12/h1-2,4-6,8H,3,7H2 |
| InChIKey | VKMIANYBNVLIIW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |