About N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate
N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate (PubChem CID 67872364) has the molecular formula C19H25N5O3S
and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate.
Molecular Properties
| Compound Name | N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate |
| PubChem CID | 67872364 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate |
| SMILES | O.O=S(=O)(CCN1CCC(Nc2nc3ncccc3[nH]2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H23N5O2S.H2O/c25-27(26,16-5-2-1-3-6-16)14-13-24-11-8-15(9-12-24)21-19-22-17-7-4-10-20-18(17)23-19;/h1-7,10,15H,8-9,11-14H2,(H2,20,21,22,23);1H2 |
| InChIKey | GBDSSPLAWOUTFY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate?
The IUPAC name of N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate (CID 67872364) is N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate.
What is the SMILES notation for N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate?
The canonical SMILES for N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate is O.O=S(=O)(CCN1CCC(Nc2nc3ncccc3[nH]2)CC1)c1ccccc1.
What is the InChIKey of N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate?
The InChIKey is GBDSSPLAWOUTFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O2S.H2O/c25-27(26,16-5-2-1-3-6-16)14-13-24-11-8-15(9-12-24)21-19-22-17-7-4-10-20-18(17)23-19;/h1-7,10,15H,8-9,11-14H2,(H2,20,21,22,23);1H2.
What are the key properties of N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate?
N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate has a molecular weight of 403.51 g/mol, XLogP of 1.48, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]-1H-imidazo[4,5-b]pyridin-2-amine;hydrate is sourced from PubChem (CID 67872364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).