About 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol
6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol (PubChem CID 67872617) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol.
Molecular Properties
| Compound Name | 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol |
| PubChem CID | 67872617 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol |
| SMILES | CCCCCCCCCCC1OCCOC1CCCCCCO |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-11-14-19-20(23-18-17-22-19)15-12-9-10-13-16-21/h19-21H,2-18H2,1H3 |
| InChIKey | KPIIIRIKTYUFPK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol?
The IUPAC name of 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol (CID 67872617) is 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol.
What is the SMILES notation for 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol?
The canonical SMILES for 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol is CCCCCCCCCCC1OCCOC1CCCCCCO.
What is the InChIKey of 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol?
The InChIKey is KPIIIRIKTYUFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-11-14-19-20(23-18-17-22-19)15-12-9-10-13-16-21/h19-21H,2-18H2,1H3.
What are the key properties of 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol?
6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol has a molecular weight of 328.54 g/mol, XLogP of 5.24, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-decyl-1,4-dioxan-2-yl)hexan-1-ol is sourced from PubChem (CID 67872617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).