About 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid
3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid (PubChem CID 67872781) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid |
| PubChem CID | 67872781 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid |
| SMILES | O=C(O)C1=C(O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C11H10O4/c12-9-6-4-1-2-5(3-4)7(6)10(13)8(9)11(14)15/h1-2,4-7,12H,3H2,(H,14,15) |
| InChIKey | GLALKOHJSMCURC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
The IUPAC name of 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid (CID 67872781) is 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid.
What is the SMILES notation for 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
The canonical SMILES for 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid is O=C(O)C1=C(O)C2C3C=CC(C3)C2C1=O.
What is the InChIKey of 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
The InChIKey is GLALKOHJSMCURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c12-9-6-4-1-2-5(3-4)7(6)10(13)8(9)11(14)15/h1-2,4-7,12H,3H2,(H,14,15).
What are the key properties of 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid has a molecular weight of 206.20 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid is sourced from PubChem (CID 67872781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).