About 2-methylideneimidazo[4,5-b]pyridine
2-methylideneimidazo[4,5-b]pyridine (PubChem CID 67872857) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 2-methylideneimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-methylideneimidazo[4,5-b]pyridine |
| PubChem CID | 67872857 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 2-methylideneimidazo[4,5-b]pyridine |
| SMILES | C=C1N=c2cccnc2=N1 |
| InChI | InChI=1S/C7H5N3/c1-5-9-6-3-2-4-8-7(6)10-5/h2-4H,1H2 |
| InChIKey | WTMQOVJAJZXMJC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylideneimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylideneimidazo[4,5-b]pyridine?
The IUPAC name of 2-methylideneimidazo[4,5-b]pyridine (CID 67872857) is 2-methylideneimidazo[4,5-b]pyridine.
What is the SMILES notation for 2-methylideneimidazo[4,5-b]pyridine?
The canonical SMILES for 2-methylideneimidazo[4,5-b]pyridine is C=C1N=c2cccnc2=N1.
What is the InChIKey of 2-methylideneimidazo[4,5-b]pyridine?
The InChIKey is WTMQOVJAJZXMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-5-9-6-3-2-4-8-7(6)10-5/h2-4H,1H2.
What are the key properties of 2-methylideneimidazo[4,5-b]pyridine?
2-methylideneimidazo[4,5-b]pyridine has a molecular weight of 131.14 g/mol, XLogP of -0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylideneimidazo[4,5-b]pyridine is sourced from PubChem (CID 67872857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).