C17H25N — CID 67873249
11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-triene (PubChem CID 67873249) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-triene.
| Compound Name | 11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-triene |
|---|---|
| PubChem CID | 67873249 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-triene |
| SMILES | CCCCCN1C=CC2=CCCC3CCC(=C23)C1 |
| InChI | InChI=1S/C17H25N/c1-2-3-4-11-18-12-10-15-7-5-6-14-8-9-16(13-18)17(14)15/h7,10,12,14H,2-6,8-9,11,13H2,1H3 |
| InChIKey | NUMURNANTJQMGW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|