About 1H-3-benzazepin-1-ol
1H-3-benzazepin-1-ol (PubChem CID 67873283) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 1H-3-benzazepin-1-ol.
Molecular Properties
| Compound Name | 1H-3-benzazepin-1-ol |
| PubChem CID | 67873283 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 1H-3-benzazepin-1-ol |
| SMILES | OC1C=NC=Cc2ccccc21 |
| InChI | InChI=1S/C10H9NO/c12-10-7-11-6-5-8-3-1-2-4-9(8)10/h1-7,10,12H |
| InChIKey | YGJMJTAQOLQTMN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-3-benzazepin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-3-benzazepin-1-ol?
The IUPAC name of 1H-3-benzazepin-1-ol (CID 67873283) is 1H-3-benzazepin-1-ol.
What is the SMILES notation for 1H-3-benzazepin-1-ol?
The canonical SMILES for 1H-3-benzazepin-1-ol is OC1C=NC=Cc2ccccc21.
What is the InChIKey of 1H-3-benzazepin-1-ol?
The InChIKey is YGJMJTAQOLQTMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c12-10-7-11-6-5-8-3-1-2-4-9(8)10/h1-7,10,12H.
What are the key properties of 1H-3-benzazepin-1-ol?
1H-3-benzazepin-1-ol has a molecular weight of 159.19 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-3-benzazepin-1-ol is sourced from PubChem (CID 67873283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).