About 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete
6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete (PubChem CID 67873488) has the molecular formula C16H19ClN2O2
and a molecular weight of 306.79 g/mol. Its IUPAC name is 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete.
Molecular Properties
| Compound Name | 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete |
| PubChem CID | 67873488 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete |
| SMILES | C1=COC1.CN1C(=O)Nc2ccc(Cl)cc2C1(C)C1CC1 |
| InChI | InChI=1S/C13H15ClN2O.C3H4O/c1-13(8-3-4-8)10-7-9(14)5-6-11(10)15-12(17)16(13)2;1-2-4-3-1/h5-8H,3-4H2,1-2H3,(H,15,17);1-2H,3H2 |
| InChIKey | ZEAUPDLOZVWRDK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete?
The IUPAC name of 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete (CID 67873488) is 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete.
What is the SMILES notation for 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete?
The canonical SMILES for 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete is C1=COC1.CN1C(=O)Nc2ccc(Cl)cc2C1(C)C1CC1.
What is the InChIKey of 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete?
The InChIKey is ZEAUPDLOZVWRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O.C3H4O/c1-13(8-3-4-8)10-7-9(14)5-6-11(10)15-12(17)16(13)2;1-2-4-3-1/h5-8H,3-4H2,1-2H3,(H,15,17);1-2H,3H2.
What are the key properties of 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete?
6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete has a molecular weight of 306.79 g/mol, XLogP of 3.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-cyclopropyl-3,4-dimethyl-1H-quinazolin-2-one;2H-oxete is sourced from PubChem (CID 67873488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).