About (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium
(1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium (PubChem CID 67873718) has the molecular formula C12H19NO4P+
and a molecular weight of 272.26 g/mol. Its IUPAC name is (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium.
Molecular Properties
| Compound Name | (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium |
| PubChem CID | 67873718 |
| Molecular Formula | C12H19NO4P+ |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium |
| SMILES | CCOC(=O)N1C=CC([P+](=O)O)C(CC)=C1CC |
| InChI | InChI=1S/C12H18NO4P/c1-4-9-10(5-2)13(12(14)17-6-3)8-7-11(9)18(15)16/h7-8,11H,4-6H2,1-3H3/p+1 |
| InChIKey | XXZYEEDOLSYRNG-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium?
The IUPAC name of (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium (CID 67873718) is (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium.
What is the SMILES notation for (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium?
The canonical SMILES for (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium is CCOC(=O)N1C=CC([P+](=O)O)C(CC)=C1CC.
What is the InChIKey of (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium?
The InChIKey is XXZYEEDOLSYRNG-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H18NO4P/c1-4-9-10(5-2)13(12(14)17-6-3)8-7-11(9)18(15)16/h7-8,11H,4-6H2,1-3H3/p+1.
What are the key properties of (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium?
(1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium has a molecular weight of 272.26 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxycarbonyl-2,3-diethyl-4H-pyridin-4-yl)-hydroxy-oxophosphanium is sourced from PubChem (CID 67873718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).