C17H16F3N3O8S2 — CID 67874555
2-acetyloxybenzoic acid;1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 67874555) has the molecular formula C17H16F3N3O8S2 and a molecular weight of 511.46 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 2-acetyloxybenzoic acid;1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 67874555 |
| Molecular Formula | C17H16F3N3O8S2 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 2-acetyloxybenzoic acid;1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.NS(=O)(=O)c1cc2c(cc1C(F)(F)F)NCNS2(=O)=O |
| InChI | InChI=1S/C9H8O4.C8H8F3N3O4S2/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;9-8(10,11)4-1-5-7(2-6(4)19(12,15)16)20(17,18)14-3-13-5/h2-5H,1H3,(H,11,12);1-2,13-14H,3H2,(H2,12,15,16) |
| InChIKey | BLCXUKWPTKFMAE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 181.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|