About 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride
2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 67874604) has the molecular formula C11H17ClN4O
and a molecular weight of 256.74 g/mol. Its IUPAC name is 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride |
| PubChem CID | 67874604 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | CCCN1C=C(C)C=C2C(=O)NC(N)N=C21.Cl |
| InChI | InChI=1S/C11H16N4O.ClH/c1-3-4-15-6-7(2)5-8-9(15)13-11(12)14-10(8)16;/h5-6,11H,3-4,12H2,1-2H3,(H,14,16);1H |
| InChIKey | BGAYAZVPDYYYBA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
The IUPAC name of 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride (CID 67874604) is 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
The canonical SMILES for 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride is CCCN1C=C(C)C=C2C(=O)NC(N)N=C21.Cl.
What is the InChIKey of 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
The InChIKey is BGAYAZVPDYYYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O.ClH/c1-3-4-15-6-7(2)5-8-9(15)13-11(12)14-10(8)16;/h5-6,11H,3-4,12H2,1-2H3,(H,14,16);1H.
What are the key properties of 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride has a molecular weight of 256.74 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-methyl-8-propyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 67874604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).