About 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride
2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 67874624) has the molecular formula C8H11ClN4O
and a molecular weight of 214.66 g/mol. Its IUPAC name is 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride |
| PubChem CID | 67874624 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | CN1C=CC=C2C(=O)NC(N)N=C21.Cl |
| InChI | InChI=1S/C8H10N4O.ClH/c1-12-4-2-3-5-6(12)10-8(9)11-7(5)13;/h2-4,8H,9H2,1H3,(H,11,13);1H |
| InChIKey | YPTZOGOIHHUWRB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
The IUPAC name of 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride (CID 67874624) is 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
The canonical SMILES for 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride is CN1C=CC=C2C(=O)NC(N)N=C21.Cl.
What is the InChIKey of 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
The InChIKey is YPTZOGOIHHUWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O.ClH/c1-12-4-2-3-5-6(12)10-8(9)11-7(5)13;/h2-4,8H,9H2,1H3,(H,11,13);1H.
What are the key properties of 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride?
2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride has a molecular weight of 214.66 g/mol, XLogP of -0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-methyl-2,3-dihydropyrido[2,3-d]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 67874624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).