C26H37F3N4O — CID 67874719
N-[4-[4-[4-amino-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]adamantane-2-carboxamide (PubChem CID 67874719) has the molecular formula C26H37F3N4O and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[4-[4-[4-amino-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]adamantane-2-carboxamide.
| Compound Name | N-[4-[4-[4-amino-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 67874719 |
| Molecular Formula | C26H37F3N4O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | N-[4-[4-[4-amino-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]adamantane-2-carboxamide |
| SMILES | Nc1ccc(N2CCN(CCCCNC(=O)C3C4CC5CC(C4)CC3C5)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H37F3N4O/c27-26(28,29)22-16-21(3-4-23(22)30)33-9-7-32(8-10-33)6-2-1-5-31-25(34)24-19-12-17-11-18(14-19)15-20(24)13-17/h3-4,16-20,24H,1-2,5-15,30H2,(H,31,34) |
| InChIKey | CYNUELURXCSZNT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|