C23H27NO2 — CID 67875463
3-methyl-2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylideneamino]benzoic acid (PubChem CID 67875463) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 3-methyl-2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylideneamino]benzoic acid.
| Compound Name | 3-methyl-2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 67875463 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-methyl-2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylideneamino]benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1/N=C/c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H27NO2/c1-15-7-6-8-17(21(25)26)20(15)24-14-16-9-10-18-19(13-16)23(4,5)12-11-22(18,2)3/h6-10,13-14H,11-12H2,1-5H3,(H,25,26)/b24-14+ |
| InChIKey | FGFPDVXXMXGJHT-ZVHZXABRSA-N |
| XLogP | 5.79 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|