C29H39N3O6 — CID 67875571
(6aR,9R,10aS)-4-ethyl-N-(4-methoxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;(Z)-but-2-enedioic acid (PubChem CID 67875571) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is (6aR,9R,10aS)-4-ethyl-N-(4-methoxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;(Z)-but-2-enedioic acid.
| Compound Name | (6aR,9R,10aS)-4-ethyl-N-(4-methoxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67875571 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | (6aR,9R,10aS)-4-ethyl-N-(4-methoxycyclohexyl)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;(Z)-but-2-enedioic acid |
| SMILES | CCn1cc2c3c(cccc31)[C@@H]1C[C@@H](C(=O)NC3CCC(OC)CC3)CN(C)[C@@H]1C2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H35N3O2.C4H4O4/c1-4-28-15-16-13-23-21(20-6-5-7-22(28)24(16)20)12-17(14-27(23)2)25(29)26-18-8-10-19(30-3)11-9-18;5-3(6)1-2-4(7)8/h5-7,15,17-19,21,23H,4,8-14H2,1-3H3,(H,26,29);1-2H,(H,5,6)(H,7,8)/b;2-1-/t17-,18?,19?,21+,23-;/m1./s1 |
| InChIKey | CRZCQQZTDRHXBX-QVZAQCKISA-N |
| XLogP | 3.41 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|