C8H10F3N3O2 — CID 67875626
3-nitro-4-(2,2,2-trifluoroethyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 67875626) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 3-nitro-4-(2,2,2-trifluoroethyl)cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 3-nitro-4-(2,2,2-trifluoroethyl)cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 67875626 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-nitro-4-(2,2,2-trifluoroethyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CC([N+](=O)[O-])C(N)(CC(F)(F)F)C=C1 |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)4-7(13)2-1-5(12)3-6(7)14(15)16/h1-3,6H,4,12-13H2 |
| InChIKey | HZOHKYUVRHPTTG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|