About 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide
3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide (PubChem CID 67876149) has the molecular formula C18H18BrN5S
and a molecular weight of 416.35 g/mol. Its IUPAC name is 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide.
Molecular Properties
| Compound Name | 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide |
| PubChem CID | 67876149 |
| Molecular Formula | C18H18BrN5S |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide |
| SMILES | CCc1nccs1.[Br-].c1ccc(-c2n[nH][n+](-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C13H10N4.C5H7NS.BrH/c1-3-7-11(8-4-1)13-14-16-17(15-13)12-9-5-2-6-10-12;1-2-5-6-3-4-7-5;/h1-10H;3-4H,2H2,1H3;1H |
| InChIKey | QISGZKZFNKCKBX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide?
The IUPAC name of 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide (CID 67876149) is 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide.
What is the SMILES notation for 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide?
The canonical SMILES for 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide is CCc1nccs1.[Br-].c1ccc(-c2n[nH][n+](-c3ccccc3)n2)cc1.
What is the InChIKey of 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide?
The InChIKey is QISGZKZFNKCKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4.C5H7NS.BrH/c1-3-7-11(8-4-1)13-14-16-17(15-13)12-9-5-2-6-10-12;1-2-5-6-3-4-7-5;/h1-10H;3-4H,2H2,1H3;1H.
What are the key properties of 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide?
3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide has a molecular weight of 416.35 g/mol, XLogP of 0.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-2H-tetrazol-3-ium;2-ethyl-1,3-thiazole;bromide is sourced from PubChem (CID 67876149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).