C14H10N6O6 — CID 67876258
[(1R,2S,4S,5S)-2,3,4,5,6-pentacyanato-3-ethylcyclohexyl] cyanate (PubChem CID 67876258) has the molecular formula C14H10N6O6 and a molecular weight of 358.27 g/mol. Its IUPAC name is [(1R,2S,4S,5S)-2,3,4,5,6-pentacyanato-3-ethylcyclohexyl] cyanate.
| Compound Name | [(1R,2S,4S,5S)-2,3,4,5,6-pentacyanato-3-ethylcyclohexyl] cyanate |
|---|---|
| PubChem CID | 67876258 |
| Molecular Formula | C14H10N6O6 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [(1R,2S,4S,5S)-2,3,4,5,6-pentacyanato-3-ethylcyclohexyl] cyanate |
| SMILES | CCC1(OC#N)[C@@H](OC#N)[C@H](OC#N)C(OC#N)[C@H](OC#N)[C@@H]1OC#N |
| InChI | InChI=1S/C14H10N6O6/c1-2-14(26-8-20)12(24-6-18)10(22-4-16)9(21-3-15)11(23-5-17)13(14)25-7-19/h9-13H,2H2,1H3/t9?,10-,11+,12-,13-,14?/m0/s1 |
| InChIKey | ZBKKHPZOVLZMNH-OBYRSOGISA-N |
| XLogP | -0.02 |
| TPSA | 198.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|