C16H32ClNO — CID 67876621
(2S,3S,4S)-2-amino-1-cyclohexyl-4-propan-2-ylhept-6-en-3-ol;hydrochloride (PubChem CID 67876621) has the molecular formula C16H32ClNO and a molecular weight of 289.89 g/mol. Its IUPAC name is (2S,3S,4S)-2-amino-1-cyclohexyl-4-propan-2-ylhept-6-en-3-ol;hydrochloride.
| Compound Name | (2S,3S,4S)-2-amino-1-cyclohexyl-4-propan-2-ylhept-6-en-3-ol;hydrochloride |
|---|---|
| PubChem CID | 67876621 |
| Molecular Formula | C16H32ClNO |
| Molecular Weight | 289.89 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (2S,3S,4S)-2-amino-1-cyclohexyl-4-propan-2-ylhept-6-en-3-ol;hydrochloride |
| SMILES | C=CC[C@@H](C(C)C)[C@H](O)[C@@H](N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C16H31NO.ClH/c1-4-8-14(12(2)3)16(18)15(17)11-13-9-6-5-7-10-13;/h4,12-16,18H,1,5-11,17H2,2-3H3;1H/t14-,15-,16-;/m0./s1 |
| InChIKey | WCWSWMVDBHWGHU-NLQWVURJSA-N |
| XLogP | 3.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|