About 5-pentoxy-3H-1,3,4-oxadiazol-2-one
5-pentoxy-3H-1,3,4-oxadiazol-2-one (PubChem CID 67876772) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 5-pentoxy-3H-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 5-pentoxy-3H-1,3,4-oxadiazol-2-one |
| PubChem CID | 67876772 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-pentoxy-3H-1,3,4-oxadiazol-2-one |
| SMILES | CCCCCOc1n[nH]c(=O)o1 |
| InChI | InChI=1S/C7H12N2O3/c1-2-3-4-5-11-7-9-8-6(10)12-7/h2-5H2,1H3,(H,8,10) |
| InChIKey | JQSAQVQEOYJNGS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentoxy-3H-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentoxy-3H-1,3,4-oxadiazol-2-one?
The IUPAC name of 5-pentoxy-3H-1,3,4-oxadiazol-2-one (CID 67876772) is 5-pentoxy-3H-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 5-pentoxy-3H-1,3,4-oxadiazol-2-one?
The canonical SMILES for 5-pentoxy-3H-1,3,4-oxadiazol-2-one is CCCCCOc1n[nH]c(=O)o1.
What is the InChIKey of 5-pentoxy-3H-1,3,4-oxadiazol-2-one?
The InChIKey is JQSAQVQEOYJNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-2-3-4-5-11-7-9-8-6(10)12-7/h2-5H2,1H3,(H,8,10).
What are the key properties of 5-pentoxy-3H-1,3,4-oxadiazol-2-one?
5-pentoxy-3H-1,3,4-oxadiazol-2-one has a molecular weight of 172.18 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentoxy-3H-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 67876772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).