C18H33NO3 — CID 67876970
tert-butyl N-[(E,2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate (PubChem CID 67876970) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl N-[(E,2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 67876970 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | tert-butyl N-[(E,2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate |
| SMILES | CC/C=C/[C@H](O)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO3/c1-5-6-12-16(20)15(13-14-10-8-7-9-11-14)19-17(21)22-18(2,3)4/h6,12,14-16,20H,5,7-11,13H2,1-4H3,(H,19,21)/b12-6+/t15-,16-/m0/s1 |
| InChIKey | YZBGTFIHWCZGPU-PZGQXFMXSA-N |
| XLogP | 4.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|