About 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid)
2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) (PubChem CID 67877072) has the molecular formula C34H54O9
and a molecular weight of 606.80 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid).
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) |
| PubChem CID | 67877072 |
| Molecular Formula | C34H54O9 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) |
| SMILES | CC(C)Cc1cc(CCCCC(=O)O)ccc1O.CC(C)Cc1cc(CCCCC(=O)O)ccc1O.OCCOCCO |
| InChI | InChI=1S/2C15H22O3.C4H10O3/c2*1-11(2)9-13-10-12(7-8-14(13)16)5-3-4-6-15(17)18;5-1-3-7-4-2-6/h2*7-8,10-11,16H,3-6,9H2,1-2H3,(H,17,18);5-6H,1-4H2 |
| InChIKey | MYVHBMLQRNKMMQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid)?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) (CID 67877072) is 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid).
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid)?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) is CC(C)Cc1cc(CCCCC(=O)O)ccc1O.CC(C)Cc1cc(CCCCC(=O)O)ccc1O.OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid)?
The InChIKey is MYVHBMLQRNKMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H22O3.C4H10O3/c2*1-11(2)9-13-10-12(7-8-14(13)16)5-3-4-6-15(17)18;5-1-3-7-4-2-6/h2*7-8,10-11,16H,3-6,9H2,1-2H3,(H,17,18);5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid)?
2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) has a molecular weight of 606.80 g/mol, XLogP of 5.76, 18 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;bis(5-[4-hydroxy-3-(2-methylpropyl)phenyl]pentanoic acid) is sourced from PubChem (CID 67877072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).