About [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate
[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate (PubChem CID 67877080) has the molecular formula C35H43F3N2O4
and a molecular weight of 612.73 g/mol. Its IUPAC name is [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate |
| PubChem CID | 67877080 |
| Molecular Formula | C35H43F3N2O4 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCCc1ccc(-c2ncc(C(=O)Oc3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C35H43F3N2O4/c1-3-5-7-9-10-11-12-14-26-16-18-27(19-17-26)32-39-24-29(25-40-32)34(42)43-30-22-20-28(21-23-30)33(41)44-31(35(36,37)38)15-13-8-6-4-2/h16-25,31H,3-15H2,1-2H3 |
| InChIKey | JUDDEFDJDCEFGO-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate?
The IUPAC name of [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate (CID 67877080) is [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate.
What is the SMILES notation for [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate?
The canonical SMILES for [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate is CCCCCCCCCc1ccc(-c2ncc(C(=O)Oc3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cn2)cc1.
What is the InChIKey of [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate?
The InChIKey is JUDDEFDJDCEFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H43F3N2O4/c1-3-5-7-9-10-11-12-14-26-16-18-27(19-17-26)32-39-24-29(25-40-32)34(42)43-30-22-20-28(21-23-30)33(41)44-31(35(36,37)38)15-13-8-6-4-2/h16-25,31H,3-15H2,1-2H3.
What are the key properties of [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate?
[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate has a molecular weight of 612.73 g/mol, XLogP of 9.71, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 2-(4-nonylphenyl)pyrimidine-5-carboxylate is sourced from PubChem (CID 67877080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).